Rilmakalim

This classification denotes an antihypertensive agent with the molecular formula C21H23NO5S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 47Y56T6LEI, chemically known as 2-pyrrolidinone, 1-(3,4-dihydro-3-hydroxy-2,2-dimethyl-6-(phenylsulfonyl)-2h-1-benzopyran-4-yl)-, (3s-trans)- but generally known as rilmakalim, which bears US NIH Compound Identifier 65966. European Medicines Agency schedules Rilmakalim in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10314MIG. The term RILMAKALIM is an International Non-Proprietary Name. Most nations schedule rilmakalim under HS 29349990 and SITC 51579. As of Q4 2014, RILMAKALIM remains the US FDA Preferred Term for this commodity. Rilmakalim bears US NLM identifiers UMLS ID C0652011 and NCI Concept Code C75239. SMILES: S(=O)(=O)(c1cc2C(N3CCCC3=O)C(O)C(Oc2cc1)(C)C)c1ccccc1.