Pentamethonium

This classification denotes a nicotinic antagonist with the molecular formula C11H28N2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 521DS2D2HB, chemically known as 1,5-pentanediaminium, n,n,n,n,n,n-hexamethyl-, dibromide (9ci) but generally known as pentamethonium bromide, which bears US NIH Compound Identifier 10919. European Medicines Agency schedules Pentamethonium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09681MIG. The term PENTAMETHONIUM is an International Non-Proprietary Name. As of Q4 2014, PENTAMETHONIUM remains the US FDA Preferred Term for this commodity. Pentamethonium bears US NLM identifiers UMLS ID C0070299 and NCI Concept Code C84044. SMILES: C[N+](C)(C)CCCCC[N+](C)(C)C.