Thenium closylate

This classification denotes an antihelminthic agent with the molecular formula C15H20NOS.C6H4ClO3S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier TU308VI4JY, chemically known as 2-thiophenemethanaminium, n,n-dimethyl-n-(2-phenoxyethyl)-, salt with 4-chlorobenzenesulfonic acid (1:1) but generally known as thenium closilate, which bears US NIH Compound Identifier 20293. European Medicines Agency schedules Thenium closilate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10961MIG. The term THENIUM CLOSILATE is an International Non-Proprietary Name. As of Q4 2014, THENIUM CLOSYLATE remains the US FDA Preferred Term for this commodity. Thenium closylate bears US NLM identifiers UMLS ID C0521914 and NCI Concept Code C84199. SMILES: C[N+](C)(CCOC1=CC=CC=C1)CC2=CC=CS2.C1=CC(=CC=C1S(=O)(=O)[O-])Cl.