Bunamidine hydrochloride

This classification denotes an antihelminthic agent with the molecular formula C25H38N2O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Y80LB0Q7CB, chemically known as 1-naphthamidine, n,n-dibutyl-4-hexyloxy-, monohydrochloride but more generally known as bunamidine hydrochloride, which bears US NIH Compound Identifier 13985. Most nations, for tariff and trade purposes, schedule bunamidine hydrochloride under HS 29252900 and SITC 51482. As of Q4 2014, BUNAMIDINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Bunamidine hydrochloride bears US NLM identifiers UMLS ID C0141753 and NCI Concept Code C75211. SMILES: CCCCCCOC1CCC(C2C1CCCC2)C(=N)N(CCCC)CCCC.CL.