Morantel

This classification denotes an antihelminthic agent with the molecular formula C12H16N2S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, 7NJ031HAX5 chemically known as (e)-1,4,5,6-tetrahydro-1-methyl-2-(2-(3-methyl-2-thienyl)vinyl)pyrimidine but generally known as morantel, which bears US NIH Compound Identifier 5353792. European Medicines Agency schedules Morantel in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09063MIG. The term MORANTEL is an International Non-Proprietary Name or INN. Most nations schedule morantel under HS 29349990 and SITC 51579. As of Q4 2014, MORANTEL remains the US FDA Preferred Term for this commodity. Morantel bears US NLM identifiers UMLS ID C0026534 and NCI Concept Code C75221. SMILES: CC1=C(SC=C1)/C=C/C2=NCCCN2C.