Crystal violet or gentian violet or methylrosaniline

This classification denotes a dye with the molecular formula C25H30N3.Cl, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier J4Z741D6O5, chemically known as pararosaniline, n,n,n,n,n,n-hexamethyl-, chloride but generally known as gentian violet, which bears US NIH Compound Identifier 3468. European Medicines Agency schedules Gentian violet in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB40253. The term GENTIAN VIOLET is an International Non-Proprietary Name. SMILES: CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-].