Fludazonium

This classification denotes an anti-infective agent with the molecular formula C26H20Cl4FN2O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier K23V2Z5820, chemically known as 1h-imidazolium, 1-(2-(2,4-dichlorophenyl)-2-((2,4-dichlorophenyl)methoxy)ethyl)-3-(2-(4-fluorophenyl)-2-oxoethyl)- but generally known as fludazonium, which bears US NIH Compound Identifier 216229. European Medicines Agency schedules Fludazonium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07679MIG. The term FLUDAZONIUM is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 29, No. 10 1975, List 15). As of Q4 2014, FLUDAZONIUM remains the US FDA Preferred Term for this commodity. Fludazonium bears US NLM identifiers UMLS ID C2828234 and NCI Concept Code C87261. SMILES: C1=CC(=CC=C1C(=O)C[N+]2=CN(C=C2)CC(C3=C(C=C(C=C3)Cl)Cl)OCC4=C(C=C(C=C4)Cl)Cl)F.