Atiprosin

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C20H29N3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, ALS52889WF chemically known as pyrazino(2',3':3,4)pyrido(1,2-a)indole, 1-ethyl-1,2,3,4,4a,5,6,12b-octahydro-12-methyl-4-(1-methylethyl)-, trans, (z)-2-butenedioate but generally known as atiprosin, which bears US NIH Compound Identifier 3034029. European Medicines Agency schedules Atiprosin in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05596MIG. The term ATIPROSIN is an International Non-Proprietary Name or INN. Most nations schedule atiprosin under HS 29335995 and SITC 51576. As of Q4 2014, ATIPROSIN remains the US FDA Preferred Term for this commodity. Atiprosin bears US NLM identifiers UMLS ID C0052594 and NCI Concept Code C77299. SMILES: CCN1CCN(C2C1C3=C(C4=CC=CC=C4N3CC2)C)C(C)C.