Atiprosin maleate

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C20H29N3.C4H4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 50SZ4782J0, chemically known as pyrazino(2,3:3,4)pyrido(1,2-a)indole, 1-ethyl-1,2,3,4,4a,5,6,12b-octahydro-12-methyl-4-(1-methylethyl)-, trans- but more generally known as atiprosin maleate, which bears US NIH Compound Identifier 3034029. Most nations, for tariff and trade purposes, schedule atiprosin maleate under HS 29335995 and SITC 51576. As of Q4 2014, ATIPROSIN MALEATE remains US FDA's Preferred Term for this commodity. Atiprosin maleate bears US NLM identifiers UMLS ID C0104775 and NCI Concept Code C87434. SMILES: CCN1CCN([C@H]2[C@H]1C3C(C4CCCCC4N3CC2)C)C(C)C.C(=C\C(=O)O)\C(=O)O.