Proroxan

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C21H23NO3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, T5WT3QN49G chemically known as 1-(1,4-benzodioxan-6-yl)-3-(3-phenyl-1-pyrrolidinyl)-1-propanone but generally known as proroxan, which bears US NIH Compound Identifier 36303. European Medicines Agency schedules Proroxan in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10130MIG. The term PROROXAN is an International Non-Proprietary Name or INN. Most nations schedule proroxan under HS 29349990 and SITC 51579. As of Q4 2014, PROROXAN remains the US FDA Preferred Term for this commodity. Proroxan bears US NLM identifiers UMLS ID C0072252 and NCI Concept Code C84119. SMILES: C1CN(CC1C2=CC=CC=C2)CCC(=O)C3=CC4=C(C=C3)OCCO4.