Proroxan hydrochloride

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C21H23NO3.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 694Z9P44G4, chemically known as 1,4-benzodioxan, 6-(3-(3-phenylpyrrolidinyl)propionyl)-, hydrochloride but more generally known as proroxan hydrochloride, which bears US NIH Compound Identifier 36302. Most nations, for tariff and trade purposes, schedule proroxan hydrochloride under HS 29349990 and SITC 51579. As of Q4 2014, PROROXAN HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Proroxan hydrochloride bears US NLM identifiers UMLS ID C0951999 and NCI Concept Code C84120. SMILES: C1CCC(CC1)C2CCN(C2)CCC(=O)C3CCC4C(C3)OCCO4.CL.