Cefquinome

This classification denotes a cephalosporin antibiotic with the molecular formula C23H24N6O5S2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, Z74S078CWP chemically known as 1-(((6r,7r)-7-(2-(2-amino-4-thiazolyl)glyoxylamido)-2-carboxy-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-3-yl)methyl)-5,6,7,8-tetrahydroquinolinium hydroxide, inner salt, 72-(z)-(o-methyloxime) but generally known as cefquinome, which bears US NIH Compound Identifier 9571084. European Medicines Agency schedules Cefquinome in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07416MIG. The term CEFQUINOME is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 3, no. 3, 1989, list 29. ). Most nations schedule cefquinome under HS 29419000 and SITC 54139. As of Q4 2014, CEFQUINOME remains the US FDA Preferred Term for this commodity. Cefquinome bears US NLM identifiers UMLS ID C0108939 and NCI Concept Code C79564. SMILES: CON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)C[N+]4=CC=CC5=C4CCCC5)C(=O)[O-].