Cefpirome sulfate

This classification denotes a cephalosporin antibiotic with the molecular formula C22H22N6O5S2.H2O4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier BA5ALU2ZT9, chemically known as 5h-1-pyrindinium, 1-((7-(((2-amino-4-thiazolyl)(methoxyimino)acetyl)amino)-2-carboxy-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-3-yl)methyl)-6,7-dihydro-, hydroxide, inner salt, (6r-(6alpha,7beta(z)))-, sulfate (1:1) but more generally known as cefpirome sulfate, which bears US NIH Compound Identifier 9570928. European Medicines Agency schedules Cefpirome sulfate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01131MIG. Most nations, for tariff and trade purposes, schedule cefpirome sulfate under HS 29419000 and SITC 54139. As of Q4 2014, CEFPIROME SULFATE remains US FDA's Preferred Term for this commodity. Cefpirome sulfate bears US NLM identifiers UMLS ID C0771341 and NCI Concept Code C87463. SMILES: CO/N=C(/C1CSC(N1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C[N+]4CCCC5C4CCC5)C(=O)[O-].OS(=O)(=O)O.