Metronidazole benzoate

This classification denotes a trichomonacide agent and protein synthesis inhibitor with the molecular formula C13H13N3O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier A355C835XC, chemically known as 2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate, but more generally known as metronidazole benzoate, which bears US NIH Compound Identifier 4173. European Medicines Agency schedules metronidazole benzoate or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08922MIG. Most nations, for tariff purposes, schedule metronidazole benzoate under HS 29332990. Metronidazole benzoate bears US NLM identifiers UMLS ID C0353490 and NCI Concept Code C87387. SMILES: CC1NCC(N1CCOC(=O)C2CCCCC2)[N+](=O)[O-].