Metronidazole phosphate

This classification denotes an antiprotozoal agent and antimicrobial with the molecular formula C6H10N3O6P, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier L500PR95QA, chemically known as 1h-imidazole-1-ethanol, 2-methyl-5-nitro-, dihydrogen phosphate (ester) but more generally known as metronidazole phosphate, which bears US NIH Compound Identifier 51794. Most nations, for tariff and trade purposes, schedule metronidazole phosphate under HS 29332990 and SITC 51573. As of Q4 2014, METRONIDAZOLE PHOSPHATE remains US FDA's Preferred Term for this commodity. Metronidazole phosphate bears US NLM identifiers UMLS ID C0887130 and NCI Concept Code C90619. SMILES: CC1NCC(N1CCOP(=O)(O)O)[N+](=O)[O-].