Nafcillin sodium anhydrous

This classification denotes a beta-lactam antibiotic with the molecular formula C21H21N2O5S.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier SY07234TTS, chemically known as sodium 6-(2-ethoxy-1-naphthamido)penicillanate, but more generally known as nafcillin sodium anhydrous, which bears US NIH Compound Identifier 64712. European Medicines Agency schedules nafcillin sodium anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09118MIG. Most nations, for tariff purposes, schedule nafcillin sodium anhydrous under HS 29411090. Nafcillin sodium anhydrous bears US NLM identifiers UMLS ID C2698426 and NCI Concept Code C76224. SMILES: CCOC1CCC2CCCCC2C1C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-].[NA+].