Oxacillin sodium anhydrous

This classification denotes a penicillin antibiotic with the molecular formula C19H18N3O5S.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 4TWD2995UP, chemically known as 4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid, 3,3-dimethyl-6-(((5-methyl-3-phenyl-4-isoxazolyl)carbonyl)amino)-7-oxo-, sodium salt (1:1), (2s,5r,6r)-, but more generally known as oxacillin sodium anhydrous, which bears US NIH Compound Identifier 64714. European Medicines Agency schedules oxacillin sodium anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09484MIG. Most nations, for tariff purposes, schedule oxacillin sodium anhydrous under HS 29411090. Oxacillin sodium anhydrous bears US NLM identifiers UMLS ID C2698675 and NCI Concept Code C76225. SMILES: CC1C(C(NO1)C2CCCCC2)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-].[NA+].