Cilobamine

This classification denotes an antidepressant agent with the molecular formula C17H23CL2NO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, 067U1T4S30 chemically known as bicyclo(2.2.2)octan-2-ol, 2-(3,4-dichlorophenyl)-3-((1-methylethyl)amino)-, cis- but generally known as cilobamine, which bears US NIH Compound Identifier 50538. European Medicines Agency schedules Cilobamine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06269MIG. The term CILOBAMINE is an International Non-Proprietary Name or INN. Most nations schedule cilobamine under HS 29221980 and SITC 51461. As of Q4 2014, CILOBAMINE remains the US FDA Preferred Term for this commodity. Cilobamine bears US NLM identifiers UMLS ID C0621295 and NCI Concept Code C81476. SMILES: CC(C)NC1C2CCC(C1(C3=CC(=C(C=C3)Cl)Cl)O)CC2.