Cinanserin hydrochloride

This classification denotes a serotonin antagonist with the molecular formula C20H24N2OS.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier F65Z32KI62, chemically known as 2-propenamide, n-(2-((3-(dimethylamino)propyl)thio)phenyl)-3-phenyl- but more generally known as cinanserin hydrochloride, which bears US NIH Compound Identifier 5475158. Most nations, for tariff and trade purposes, schedule cinanserin hydrochloride under HS 29309085 and SITC 51549. As of Q4 2014, CINANSERIN HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Cinanserin hydrochloride bears US NLM identifiers UMLS ID C0242221 and NCI Concept Code C83625. SMILES: CN(C)CCCSC1CCCCC1NC(=O)/C=C/C2CCCCC2.CL.