Tofenacin

This classification denotes an antimuscarinic agent with the molecular formula C17H21NO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, C4A112M10H chemically known as ethanamine, n-methyl-2-((2-methylphenyl)phenylmethoxy)- but generally known as tofenacin, which bears US NIH Compound Identifier 25315. European Medicines Agency schedules Tofenacin in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB11142MIG. The term TOFENACIN is an International Non-Proprietary Name or INN. Most nations schedule tofenacin under HS 29221980 and SITC 51461. As of Q4 2014, TOFENACIN remains the US FDA Preferred Term for this commodity. Tofenacin bears US NLM identifiers UMLS ID C0076783 and NCI Concept Code C81546. SMILES: CC1=CC=CC=C1C(C2=CC=CC=C2)OCCNC.