Deprodone

This classification denotes a therapeutic glucocorticoid with the molecular formula C21H28O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, Z380L7N00P chemically known as 11.beta.,17-dihydroxypregna-1,4-diene-3,20-dione but generally known as deprodone, which bears US NIH Compound Identifier 89339. European Medicines Agency schedules Deprodone in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06982MIG. The term DEPRODONE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 2, no. 3, 1988, list 28. ). Most nations schedule deprodone under HS 29372900 and SITC 54153. As of Q4 2014, DEPRODONE remains the US FDA Preferred Term for this commodity. Deprodone bears US NLM identifiers UMLS ID C2699591 and NCI Concept Code C77412. SMILES: CC(=O)C1(CCC2C1(CC(C3C2CCC4=CC(=O)C=CC34C)O)C)O.