Diclofensine

This classification denotes an antidepressant agent with the molecular formula C17H17CL2NO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, 09HKW863J6 chemically known as (+/-)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-7-methoxy-2-methylisoquinoline but generally known as diclofensine, which bears US NIH Compound Identifier 68871. European Medicines Agency schedules Diclofensine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07094MIG. The term DICLOFENSINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 35, no. 5 1981, list 21. ). Most nations schedule diclofensine under HS 29334990 and SITC 51575. As of Q4 2014, DICLOFENSINE remains the US FDA Preferred Term for this commodity. Diclofensine bears US NLM identifiers UMLS ID C0057877 and NCI Concept Code C78017. SMILES: CLC1CC(C2CN(CC3C2CCC(OC)C3)C)CCC1CL.