Nomifensine maleate

This classification denotes an antidepressant agent with the molecular formula C16H18N2.C4H4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 76S8CUH5MR, chemically known as 1,2,3,4-tetrahydro-2-methyl-4-phenyl-8-isoquino* but more generally known as nomifensine maleate, which bears US NIH Compound Identifier 4528. European Medicines Agency schedules Nomifensine maleate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB14663MIG. Most nations, for tariff and trade purposes, schedule nomifensine maleate under HS 29334990 and SITC 51575. As of Q4 2014, NOMIFENSINE MALEATE remains US FDA's Preferred Term for this commodity. Nomifensine maleate bears US NLM identifiers UMLS ID C0877847 and NCI Concept Code C73808. SMILES: CN1CC2C(CCCC2N)C(C1)C3CCCCC3.C(=C\C(=O)O)\C(=O)O.