Lometraline hydrochloride

This classification denotes an antiparkinsonian agent with the molecular formula C13H18ClNO.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier T2OJ193WGR, chemically known as 8-chloro-1,2,3,4-tetrahydro-5-methoxy-n,n-dimethyl-1-naphthylamine hydrochloride but more generally known as lometraline hydrochloride, which bears US NIH Compound Identifier 34788. Most nations, for tariff and trade purposes, schedule lometraline hydrochloride under HS 29222900 and SITC 51462. As of Q4 2014, LOMETRALINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Lometraline hydrochloride bears US NLM identifiers UMLS ID C0888036 and NCI Concept Code C81563. SMILES: CN(C)C1CCCC2C1C(CCC2OC)CL.CL.