Pentiapine maleate

This classification denotes a dopamine antagonist with the molecular formula C15H17N5S.C4H4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Z5P36MQ43L, chemically known as 5-(4-methyl-1-piperazinyl)imidazo(2,1-b)(1,3,5)benzothiadiazepine maleate (1:1) but more generally known as pentiapine maleate, which bears US NIH Compound Identifier 6435401. Most nations, for tariff and trade purposes, schedule pentiapine maleate under HS 29349990 and SITC 51579. As of Q4 2014, PENTIAPINE MALEATE remains US FDA's Preferred Term for this commodity. Pentiapine maleate bears US NLM identifiers UMLS ID C0055211 and NCI Concept Code C90844. SMILES: CN1CCN(CC1)C2=NC3CCCCC3SC4N2CCN4.C(=C\C(=O)O)\C(=O)O.