Ganciclovir sodium

This classification denotes a purine antagonist and antiviral agent with the molecular formula C9H12N5O4.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 02L083W284, chemically known as 9-(1,3-dihydroxy-propoxymethane)guanine but more generally known as ganciclovir sodium, which bears US NIH Compound Identifier 3454. European Medicines Agency schedules Ganciclovir sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02312MIG. Most nations, for tariff and trade purposes, schedule ganciclovir sodium under HS 29335995 and SITC 51576. As of Q4 2014, GANCICLOVIR SODIUM remains US FDA's Preferred Term for this commodity. Ganciclovir sodium bears US NLM identifiers UMLS ID C0282399 and NCI Concept Code C1588. SMILES: C1NC2C(=O)[N-]C(NC2N1COC(CO)CO)N.[NA+].