Penciclovir sodium

This classification denotes a purine antagonist and antiviral agent with the molecular formula C10H14N5O3.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier P06226385L, chemically known as 1,9-dihydro-2-amino-9-(4-hydroxy-3-(hydroxymethyl)butyl)-6h-purin-6-one monosodium salt but more generally known as penciclovir sodium, which bears US NIH Compound Identifier 656702. Most nations, for tariff and trade purposes, schedule penciclovir sodium under HS 29335995 and SITC 51576. As of Q4 2014, PENCICLOVIR SODIUM remains US FDA's Preferred Term for this commodity. Penciclovir sodium bears US NLM identifiers UMLS ID C0719742 and NCI Concept Code C47656. SMILES: C1NC2C(=O)[N-]C(NC2N1CCC(CO)CO)N.[NA+].