Trioxifene

This classification denotes a selective estrogen receptor modulator with the molecular formula C30H31NO3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, R0130F043H chemically known as 3,4-dihydro-2-(p-methoxyphenyl)-1-naphthyl p-(2-(1-pyrrolidinyl)ethoxy)phenyl ketone but generally known as trioxifene, which bears US NIH Compound Identifier 50139. European Medicines Agency schedules Trioxifene in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB11317MIG. The term TRIOXIFENE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 33, no. 10 1979, list 19). Most nations schedule trioxifene under HS 29339990 and SITC 51577. As of Q4 2014, TRIOXIFENE remains the US FDA Preferred Term for this commodity. Trioxifene bears US NLM identifiers UMLS ID C0077238 and NCI Concept Code C1266. SMILES: COC1=CC=C(C=C1)C2=C(C3=CC=CC=C3CC2)C(=O)C4=CC=C(C=C4)OCCN5CCCC5.