Arzoxifene hydrochloride

This classification denotes a selective estrogen receptor modulator with the molecular formula C28H29NO4S.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier FU88PI0433, chemically known as benzo(b)thiophene-6-ol, 2-(4-methoxyphenyl)-3-(4-(2-(1-piperidinyl)ethoxy)phenoxy)-, hydrochloride but more generally known as arzoxifene hydrochloride, which bears US NIH Compound Identifier 179338. The base compound, Arzoxifene, most often comes in base and hydrochloride forms. Most nations, for tariff and trade purposes, schedule arzoxifene hydrochloride under HS 29349990 and SITC 51579. As of Q4 2014, ARZOXIFENE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Arzoxifene hydrochloride bears US NLM identifiers UMLS ID C0950979 and NCI Concept Code C2460. SMILES: COC1CCC(CC1)C2C(C3CCC(CC3S2)O)OC4CCC(CC4)OCCN5CCCCC5.CL.