Dihydroergocristine

This classification denotes a dopamine agonist and alpha-adrenergic blocking agent with the molecular formula C35H41N5O5, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 05D48LUM4Z, chemically known as ergocristine, dihydro- but generally known as dihydroergocristine, which bears US NIH Compound Identifier 3065. European Medicines Agency schedules Dihydroergocristine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13586MIG. World Health Organization schedules dihydroergocristine in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, DIHYDROERGOCRISTINE remains the US FDA Preferred Term for this commodity. Dihydroergocristine bears US NLM identifiers UMLS ID C0012289 and NCI Concept Code C75938. SMILES: O1C2(O)N(C(C(=O)N3C2CCC3)Cc2ccccc2)C(=O)C1(NC(=O)C1CC2C(N(C1)C)Cc1c3c2cccc3[nH]c1)C(C)C.