Endralazine mesilate or mesylate

This classification denotes a vasodilating agent with the molecular formula C14H15N5O.CH4O3S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 333M5986I5, chemically known as 6-benzoyl-5,6,7,8-tetrahydropyrido(4,3-c)pyridazin-3(2h)-one hydrazone monomethanesulfonate but more generally known as endralazine mesilate, which bears US NIH Compound Identifier 47607. European Medicines Agency schedules Endralazine mesilate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01886MIG. Most nations, for tariff and trade purposes, schedule endralazine mesylate under HS 29339990. As of Q4 2014, ENDRALAZINE MESYLATE remains US FDA's Preferred Term for this commodity. Endralazine mesylate bears US NLM identifiers UMLS ID C2699995 and NCI Concept Code C77075. SMILES: CS(=O)(=O)O.C1CCC(CC1)C(=O)N2CCC3C(C/C(=N/N)/[NH]N3)C2.