Loteprednol etabonate

This classification denotes a therapeutic glucocorticoid with the molecular formula C24H31ClO7, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier YEH1EZ96K6, chemically known as chloromethyl 17a-ethoxycarbonyloxy-11b-hydroxyandrosta-1,4-diene-3-one-17b-carbo but more generally known as loteprednol etabonate, which bears US NIH Compound Identifier 54808. European Medicines Agency schedules Loteprednol etabonate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB14390MIG. Most nations, for tariff and trade purposes, schedule loteprednol etabonate under HS 29372900 and SITC 54153. As of Q4 2014, LOTEPREDNOL ETABONATE remains US FDA's Preferred Term for this commodity. Loteprednol etabonate bears US NLM identifiers UMLS ID C0126177 and NCI Concept Code C47589. SMILES: CCOC(=O)O[C@@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)C(=O)OCCL.