Timobesone acetate

This classification denotes a therapeutic glucocorticoid with the molecular formula C24H31FO5S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier LGO8R495QW, chemically known as s-methyl 9-fluoro-11beta,17-dihydroxy-16beta-methyl-3-oxoandrosta-1,4-diene-17beta-carbothioate, 17-acetate but more generally known as timobesone acetate, which bears US NIH Compound Identifier 3033679. Most nations, for tariff and trade purposes, schedule timobesone acetate under HS 29372200 and SITC 54153. As of Q4 2014, TIMOBESONE ACETATE remains US FDA's Preferred Term for this commodity. Timobesone acetate bears US NLM identifiers UMLS ID C0637015 and NCI Concept Code C90957. SMILES: C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)SC)OC(=O)C)C)O)F)C.