Santonin

This classification denotes an antihelminthic agent with the molecular formula C15H18O3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 1VL8J38ERO, chemically known as 11-epiisoeusantona-1,4-dienic acid, 6alpha-hydroxy-3-oxo-, gamma-lactone but generally known as alpha-santonin, which bears US NIH Compound Identifier 10201. European Medicines Agency schedules Santonin in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB15192MIG. As of Q4 2014, SANTONIN remains the US FDA Preferred Term for this commodity. Santonin bears US NLM identifiers UMLS ID C0036179 and NCI Concept Code C87627. SMILES: CC1C2CCC3(C=CC(=O)C(=C3C2OC1=O)C)C.