Decamethrin or deltamethrin

This classification denotes an insecticide, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 2JTS8R821G, generally arising with the molecular formula C22H19Br2NO3, chemically known as [(S)-cyano-(3-phenoxyphenyl)methyl](1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate but generally known as Decamethrin or deltamethrin, which bears US NIH Compound Identifier 40585. European Medicines Agency schedules Decamethrin or deltamethrin in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13539MIG. Decamethrin or deltamethrin bears US NLM identifiers UMLS ID C0057233 and NCI Concept Code C83658. SMILES: CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Br)Br)C.