Omaciclovir

This classification denotes an antiviral agent with the molecular formula C10H15N5O3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier C9H909GLI3, chemically known as 6h-purin-6-one, 2-amino-1,9-dihydro-9-(4-hydroxy-2-(hydroxymethyl)butyl)- (r)-; but generally known as omaciclovir, which bears US NIH Compound Identifier 3047801. The term OMACICLOVIR is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 15 No. 3-4, 2001, List 46). Most nations schedule omaciclovir under HS 29335995 and SITC 51576. As of Q4 2014, OMACICLOVIR remains the US FDA Preferred Term for this commodity. Omaciclovir bears US NLM identifiers UMLS ID C2983879 and NCI Concept Code C90785. SMILES: C1=NC2=C(N1CC(CCO)CO)NC(=NC2=O)N.