Memotine hydrochloride

This classification denotes an antiviral agent with the molecular formula C17H17NO2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier ZP0HNU59MM, chemically known as isoquinoline, 3,4-dihydro-1-(4-methoxyphenoxy)methyl]-, hydrochloride but more generally known as memotine hydrochloride, which bears US NIH Compound Identifier 25350. Most nations, for tariff and trade purposes, schedule memotine hydrochloride under HS 29334990 and SITC 51575. As of Q4 2014, MEMOTINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Memotine hydrochloride bears US NLM identifiers UMLS ID C2981325 and NCI Concept Code C87665. SMILES: COC1CCC(CC1)OCC2=NCCC3C2CCCC3.CL.