Opaviraline

This classification denotes a reverse transcriptase inhibitor with the molecular formula C14H17FN2O3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Q3A8EU2NMU, chemically known as 1(2h)-quinoxalinecarboxylic acid, 2-ethyl-7-fluoro-3,4-dihydro-3-oxo-, 1-methylethyl ester, (2s)- but generally known as opaviraline, which bears US NIH Compound Identifier 154048. The term OPAVIRALINE is an International Non-Proprietary Name. Most nations schedule opaviraline under HS 29339990 and SITC 51577. As of Q4 2014, OPAVIRALINE remains the US FDA Preferred Term for this commodity. Opaviraline bears US NLM identifiers UMLS ID C0910816 and NCI Concept Code C90786. SMILES: CCC1C(=O)NC2=C(N1C(=O)OC(C)C)C=C(C=C2)F.